Products 721416-38-2

CAS 721416-38-2 is the registry number for 4-(2-Ethoxy-phenoxy)-butyric acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

4-(2-ethoxyphenoxy)butanoic acid (CAS 721416-38-2) is a chemical compound with the molecular formula C12H16O4 and a molecular weight of 224.25 g/mol. IUPAC name: 4-(2-ethoxyphenoxy)butanoic acid. InChIKey: IRVVRBZLDZLBTI-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O4
Molecular weight224.25 g/mol
IUPAC name4-(2-ethoxyphenoxy)butanoic acid
InChIKeyIRVVRBZLDZLBTI-UHFFFAOYSA-N
SMILESCCOC1=CC=CC=C1OCCCC(=O)O

Computed by PubChem (NCBI)