Products 91555-65-6
CAS 91555-65-6 appears in our catalog under these names: 3-[2-(Benzyloxy)ethoxy]propanoic acid, 98%, Benzyl–PEG2–acid, Benzyl-PEG2-acid 98%, 3-[2-(Benzyloxy)ethoxy]propanoic Acid, 97%, 97%, Benzyl-PEG2-acid, 99.41%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 100mg, 1 g.
3-(2-phenylmethoxyethoxy)propanoic acid (CAS 91555-65-6) is a chemical compound with the molecular formula C12H16O4 and a molecular weight of 224.25 g/mol. IUPAC name: 3-(2-phenylmethoxyethoxy)propanoic acid. InChIKey: SUIUDJXITUDGOR-UHFFFAOYSA-N.
| Molecular formula | C12H16O4 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | 3-(2-phenylmethoxyethoxy)propanoic acid |
| InChIKey | SUIUDJXITUDGOR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCCOCCC(=O)O |
Computed by PubChem (NCBI)