Products 52009-55-9

CAS 52009-55-9 is the registry number for 3-Ethoxy-4-propoxybenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-ethoxy-4-propoxybenzoic acid (CAS 52009-55-9) is a chemical compound with the molecular formula C12H16O4 and a molecular weight of 224.25 g/mol. IUPAC name: 3-ethoxy-4-propoxybenzoic acid. InChIKey: LYELHFOIWWRZNU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O4
Molecular weight224.25 g/mol
IUPAC name3-ethoxy-4-propoxybenzoic acid
InChIKeyLYELHFOIWWRZNU-UHFFFAOYSA-N
SMILESCCCOC1=C(C=C(C=C1)C(=O)O)OCC

Computed by PubChem (NCBI)