cas: 2246880-24-8 — see every product listed under this CAS number, including other names
2-(3,4-Dihydro-2H-1,5-benzodioxepin-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 96%, 96% (CAS 2246880-24-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JQY7-100mg |
| cas | 2246880-24-8 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln | |
| Chemat | 5g | 2334.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2246880-24-8) is a chemical compound with the molecular formula C15H21BO4 and a molecular weight of 276.14 g/mol. IUPAC name: 2-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VIAFPVWOWXAZPP-UHFFFAOYSA-N.
| Molecular formula | C15H21BO4 |
|---|---|
| Molecular weight | 276.14 g/mol |
| IUPAC name | 2-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VIAFPVWOWXAZPP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)OCCCO3 |
Computed by PubChem (NCBI)