cas: 69807-91-6 — see every product listed under this CAS number, including other names
2-(3,5-Bis(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 96%, 96% (CAS 69807-91-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FB7J-250mg |
| cas | 69807-91-6 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 107.60 Pln | |
| Chemat | 25g | 174.80 Pln | |
| Chemat | 100g | 506.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-[3,5-bis(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 69807-91-6) is a chemical compound with the molecular formula C14H15BF6O2 and a molecular weight of 340.07 g/mol. IUPAC name: 2-[3,5-bis(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GGMXSSNJKVWXMD-UHFFFAOYSA-N.
| Molecular formula | C14H15BF6O2 |
|---|---|
| Molecular weight | 340.07 g/mol |
| IUPAC name | 2-[3,5-bis(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GGMXSSNJKVWXMD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)