cas: 69807-91-6 — see every product listed under this CAS number, including other names
2-(3,5-Bis(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 69807-91-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F228815-10G |
| cas | 69807-91-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 154.13 Pln | |
| Fluorochem | 25g | 268.67 Pln | |
| Fluorochem | 100g | 799.74 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-[3,5-bis(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 69807-91-6) is a chemical compound with the molecular formula C14H15BF6O2 and a molecular weight of 340.07 g/mol. IUPAC name: 2-[3,5-bis(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GGMXSSNJKVWXMD-UHFFFAOYSA-N.
| Molecular formula | C14H15BF6O2 |
|---|---|
| Molecular weight | 340.07 g/mol |
| IUPAC name | 2-[3,5-bis(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GGMXSSNJKVWXMD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)