cas: 69807-91-6 — see every product listed under this CAS number, including other names
2-[3,5-Bis(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >98.0%(GC)(T) (CAS 69807-91-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B5095-1G |
| cas | 69807-91-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 162.60 Pln | |
| TCI | 5g | 580.57 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2-[3,5-bis(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 69807-91-6) is a chemical compound with the molecular formula C14H15BF6O2 and a molecular weight of 340.07 g/mol. IUPAC name: 2-[3,5-bis(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GGMXSSNJKVWXMD-UHFFFAOYSA-N.
| Molecular formula | C14H15BF6O2 |
|---|---|
| Molecular weight | 340.07 g/mol |
| IUPAC name | 2-[3,5-bis(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GGMXSSNJKVWXMD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)