CAS 1092938-92-5 appears in our catalog under these names: 2-(4-Methoxycyclohex-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 4-Methoxycyclohexene-1-boronic Acid Pinacol Ester, 4–Methoxycyclohexene–1–boronic Acid Pinacol Ester, 2-(4-Methoxycyclohex-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, 4-Methoxycyclohexene-1-boronic Acid Pinacol Ester, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 10g, 5g, 1g, 500mg, 50mg, 2,5g, 100mg.
2-(4-methoxycyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1092938-92-5) is a chemical compound with the molecular formula C13H23BO3 and a molecular weight of 238.13 g/mol. IUPAC name: 2-(4-methoxycyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: PUJKAJRQPDUAFS-UHFFFAOYSA-N.
| Molecular formula | C13H23BO3 |
|---|---|
| Molecular weight | 238.13 g/mol |
| IUPAC name | 2-(4-methoxycyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | PUJKAJRQPDUAFS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCC(CC2)OC |
Computed by PubChem (NCBI)