CAS 2797244-81-4 is the registry number for (Z)-7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-en-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-en-3-one (CAS 2797244-81-4) is a chemical compound with the molecular formula C13H23BO3 and a molecular weight of 238.13 g/mol. IUPAC name: (Z)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-en-3-one. InChIKey: MTVMRIGTDVKSMB-NTMALXAHSA-N.
| Molecular formula | C13H23BO3 |
|---|---|
| Molecular weight | 238.13 g/mol |
| IUPAC name | (Z)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-en-3-one |
| InChIKey | MTVMRIGTDVKSMB-NTMALXAHSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C\CCC(=O)CC |
Computed by PubChem (NCBI)