cas: 850411-08-4 — see every product listed under this CAS number, including other names
2-(3-((1,3-Dioxolan-2-yl)methoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% (CAS 850411-08-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F601987-100MG |
| cas | 850411-08-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 404.04 Pln | |
| Fluorochem | 1g | 1403.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-[3-(1,3-dioxolan-2-ylmethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 850411-08-4) is a chemical compound with the molecular formula C16H23BO5 and a molecular weight of 306.2 g/mol. IUPAC name: 2-[3-(1,3-dioxolan-2-ylmethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: TZLCWSFHDYVTQX-UHFFFAOYSA-N.
| Molecular formula | C16H23BO5 |
|---|---|
| Molecular weight | 306.2 g/mol |
| IUPAC name | 2-[3-(1,3-dioxolan-2-ylmethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | TZLCWSFHDYVTQX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCC3OCCO3 |
Computed by PubChem (NCBI)