CAS 850411-07-3 appears in our catalog under these names: 3-(2-Ethoxy-2-oxoethoxy)phenylboronic acid, pinacol ester, 98%, 98%, Ethyl 2-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)acetate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate (CAS 850411-07-3) is a chemical compound with the molecular formula C16H23BO5 and a molecular weight of 306.2 g/mol. IUPAC name: ethyl 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate. InChIKey: IUEPWIKFOCKVEU-UHFFFAOYSA-N.
| Molecular formula | C16H23BO5 |
|---|---|
| Molecular weight | 306.2 g/mol |
| IUPAC name | ethyl 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate |
| InChIKey | IUEPWIKFOCKVEU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCC(=O)OCC |
Computed by PubChem (NCBI)