CAS 2340391-64-0 appears in our catalog under these names: 3-Methoxy-4-methoxycarbonyl-5-methylphenylboronic acid pinacol ester, 98%, Methyl 2-methoxy-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g.
Methyl 2-methoxy-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2340391-64-0) is a chemical compound with the molecular formula C16H23BO5 and a molecular weight of 306.2 g/mol. IUPAC name: methyl 2-methoxy-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: FBSFCSJTAXYVFA-UHFFFAOYSA-N.
| Molecular formula | C16H23BO5 |
|---|---|
| Molecular weight | 306.2 g/mol |
| IUPAC name | methyl 2-methoxy-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | FBSFCSJTAXYVFA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)OC)C(=O)OC)C |
Computed by PubChem (NCBI)