Products 1218789-54-8

CAS 1218789-54-8 is the registry number for 3-Ethoxy-5-(methoxycarbonyl)phenylboronic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 3-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1218789-54-8) is a chemical compound with the molecular formula C16H23BO5 and a molecular weight of 306.2 g/mol. IUPAC name: methyl 3-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: YCYXPSGJPZOSTO-UHFFFAOYSA-N.

Identity
Molecular formulaC16H23BO5
Molecular weight306.2 g/mol
IUPAC namemethyl 3-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate
InChIKeyYCYXPSGJPZOSTO-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OCC)C(=O)OC

Computed by PubChem (NCBI)