cas: 651030-56-7 — see every product listed under this CAS number, including other names
2-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethanol, 97% (CAS 651030-56-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F234198-250MG |
| cas | 651030-56-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 341.56 Pln | |
| Fluorochem | 2.5g | 763.29 Pln | |
| Fluorochem | 5g | 1440.14 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanol (CAS 651030-56-7) is a chemical compound with the molecular formula C14H21BO3 and a molecular weight of 248.13 g/mol. IUPAC name: 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanol. InChIKey: NJOVPKLUJRKAGP-UHFFFAOYSA-N.
| Molecular formula | C14H21BO3 |
|---|---|
| Molecular weight | 248.13 g/mol |
| IUPAC name | 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanol |
| InChIKey | NJOVPKLUJRKAGP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CCO |
Computed by PubChem (NCBI)