2-(3-(Benzyloxy)propyl)propane-1,3-diol, 95%
cas: 132970-27-5 — see every product listed under this CAS number, including other names
2-(3-(Benzyloxy)propyl)propane-1,3-diol, 95% (CAS 132970-27-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12XC9A-100mg |
| cas | 132970-27-5 |
| size | 100mg |
| availability | 250g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 414.80 Pln | |
| Chemat | 5g | 1293.20 Pln | |
| Chemat | 25g | 4254.80 Pln | |
| Fluorochem | 100mg | 211.40 Pln | |
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 747.67 Pln | |
| Fluorochem | 5g | 2398.13 Pln | |
| Fluorochem | 25g | 7745.21 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(3-phenylmethoxypropyl)propane-1,3-diol (CAS 132970-27-5) is a chemical compound with the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. IUPAC name: 2-(3-phenylmethoxypropyl)propane-1,3-diol. InChIKey: RZXJFSQQRBRPBQ-UHFFFAOYSA-N.
| Molecular formula | C13H20O3 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 2-(3-phenylmethoxypropyl)propane-1,3-diol |
| InChIKey | RZXJFSQQRBRPBQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCCCC(CO)CO |
Computed by PubChem (NCBI)