cas: 1073353-44-2 — see every product listed under this CAS number, including other names
2-(3-(Chloromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98% (CAS 1073353-44-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A925391-250mg |
| cas | 1073353-44-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1037.88 Pln | |
| Ambeed | 25g | 3424.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A925391 |
2-[3-(chloromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1073353-44-2) is a chemical compound with the molecular formula C13H18BClO2 and a molecular weight of 252.55 g/mol. IUPAC name: 2-[3-(chloromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: KWUGBVHPELQIAF-UHFFFAOYSA-N.
| Molecular formula | C13H18BClO2 |
|---|---|
| Molecular weight | 252.55 g/mol |
| IUPAC name | 2-[3-(chloromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | KWUGBVHPELQIAF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CCl |
Computed by PubChem (NCBI)