Products 1144097-12-0
CAS 1144097-12-0 appears in our catalog under these names: 2-Chloro-4-methylphenylboronic acid pinacol ester, 95%, 2-(2-Chloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98+%, 2-(2-Chloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg, 25g.
2-(2-chloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1144097-12-0) is a chemical compound with the molecular formula C13H18BClO2 and a molecular weight of 252.55 g/mol. IUPAC name: 2-(2-chloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JQGJYYVZYCVUFV-UHFFFAOYSA-N.
| Molecular formula | C13H18BClO2 |
|---|---|
| Molecular weight | 252.55 g/mol |
| IUPAC name | 2-(2-chloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JQGJYYVZYCVUFV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C)Cl |
Computed by PubChem (NCBI)