CAS 1352426-91-5 appears in our catalog under these names: 5-Chloro-2-methylphenylboronic acid pinacol ester, 5-Chloro-2-methylphenylboronic acid, pinacol ester, 98%, 2-(5-Chloro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, 2-(5-Chloro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Biosynth, Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 0,25g, 2,5g, 10g, 100g, 25g, 5g, 1g, 100mg.
2-(5-chloro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1352426-91-5) is a chemical compound with the molecular formula C13H18BClO2 and a molecular weight of 252.55 g/mol. IUPAC name: 2-(5-chloro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MDQXWEUUJCYVMT-UHFFFAOYSA-N.
| Molecular formula | C13H18BClO2 |
|---|---|
| Molecular weight | 252.55 g/mol |
| IUPAC name | 2-(5-chloro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MDQXWEUUJCYVMT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)Cl)C |
Computed by PubChem (NCBI)