CAS 1072945-04-0 appears in our catalog under these names: 4-Chloromethylphenylboronic acid, pinacol ester, 98%, 4-Chloromethylphenylboronic acid pinacol ester, 95-<97%, 4-Chloromethylphenylboronic acid pinacol ester, ≥97-<99%, 2-(4-(Chloromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, 2-(4-(Chloromethyl)Phenyl)-4,4,5,5-Tetramethyl-1,3,2-Dioxaborolane, 98%, 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 50g, 100g, 200g, 300g.
2-[4-(chloromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1072945-04-0) is a chemical compound with the molecular formula C13H18BClO2 and a molecular weight of 252.55 g/mol. IUPAC name: 2-[4-(chloromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BCRBYHCRLQCNNV-UHFFFAOYSA-N.
| Molecular formula | C13H18BClO2 |
|---|---|
| Molecular weight | 252.55 g/mol |
| IUPAC name | 2-[4-(chloromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BCRBYHCRLQCNNV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CCl |
Computed by PubChem (NCBI)