cas: 1450828-21-3 — see every product listed under this CAS number, including other names
2-(3-(Trifluoromethyl)phenyl)-1,3,4-oxadiazole, 98% (CAS 1450828-21-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1646345-25g |
| cas | 1450828-21-3 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 47801.32 Pln | |
| AmBeed | 10g | 24358.81 Pln | |
| AmBeed | 5g | 14372.47 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole (CAS 1450828-21-3) is a chemical compound with the molecular formula C9H5F3N2O and a molecular weight of 214.14 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole. InChIKey: UJFQECRHXRCGAI-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O |
|---|---|
| Molecular weight | 214.14 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole |
| InChIKey | UJFQECRHXRCGAI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=NN=CO2 |
Computed by PubChem (NCBI)