cas: 77147-14-9 — see every product listed under this CAS number, including other names
2-(3-Aminobenzyl)isoindoline-1,3-dione, 98% (CAS 77147-14-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A453888-1g |
| cas | 77147-14-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 2778.16 Pln | |
| AmBeed | 5g | 8194.48 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[(3-aminophenyl)methyl]isoindole-1,3-dione (CAS 77147-14-9) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: 2-[(3-aminophenyl)methyl]isoindole-1,3-dione. InChIKey: FOBVDBSEYFIUCA-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 2-[(3-aminophenyl)methyl]isoindole-1,3-dione |
| InChIKey | FOBVDBSEYFIUCA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC3=CC(=CC=C3)N |
Computed by PubChem (NCBI)