cas: 27798-44-3 — see every product listed under this CAS number, including other names
2-(3-Bromophenyl)acetophenone (CAS 27798-44-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113URW-100mg |
| cas | 27798-44-3 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 328.40 Pln |
| delivery time | 3 weeks |
|---|
2-(3-bromophenyl)-1-phenylethanone (CAS 27798-44-3) is a chemical compound with the molecular formula C14H11BrO and a molecular weight of 275.14 g/mol. IUPAC name: 2-(3-bromophenyl)-1-phenylethanone. InChIKey: RUTOZYXOYXWKPS-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO |
|---|---|
| Molecular weight | 275.14 g/mol |
| IUPAC name | 2-(3-bromophenyl)-1-phenylethanone |
| InChIKey | RUTOZYXOYXWKPS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)