cas: 71703-15-6 — see every product listed under this CAS number, including other names
2-(3-Bromophenyl)isothiazolidine 1,1-dioxide 98% (CAS 71703-15-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A539689-250mg |
| cas | 71703-15-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 854.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A539689 |
2-(3-bromophenyl)-1,2-thiazolidine 1,1-dioxide (CAS 71703-15-6) is a chemical compound with the molecular formula C9H10BrNO2S and a molecular weight of 276.15 g/mol. IUPAC name: 2-(3-bromophenyl)-1,2-thiazolidine 1,1-dioxide. InChIKey: PDZFOXCQQCMSHZ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2S |
|---|---|
| Molecular weight | 276.15 g/mol |
| IUPAC name | 2-(3-bromophenyl)-1,2-thiazolidine 1,1-dioxide |
| InChIKey | PDZFOXCQQCMSHZ-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)