cas: 1239233-87-4 — see every product listed under this CAS number, including other names
2-(3-Carboxy-4-isobutoxyphenyl)-4-methylthiazole-5-carboxylic acid, 98%, 98% (CAS 1239233-87-4) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110E9L-5mg |
| cas | 1239233-87-4 |
| size | 5mg |
| availability | 0.02g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 798.80 Pln | |
| Chemat | 10mg | 1245.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[3-carboxy-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 1239233-87-4) is a chemical compound with the molecular formula C16H17NO5S and a molecular weight of 335.4 g/mol. IUPAC name: 2-[3-carboxy-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: WSCLTDCYZOTAKS-UHFFFAOYSA-N.
| Molecular formula | C16H17NO5S |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 2-[3-carboxy-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | WSCLTDCYZOTAKS-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=C(C=C2)OCC(C)C)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)