Febuxostat dicarboxylic acid impurity, 98%
cas: 1239233-87-4 — see every product listed under this CAS number, including other names
Febuxostat dicarboxylic acid impurity, 98% (CAS 1239233-87-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 50mg, 5mg, 10mg, 25mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A611386-250mg |
| cas | 1239233-87-4 |
| size | 250mg |
| availability | Synthetic Items: 0g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 13474.09 Pln | |
| AmBeed | 50mg | 4535.86 Pln | |
| Fluorochem | 5mg | 716.43 Pln | |
| Fluorochem | 10mg | 1106.92 Pln | |
| Fluorochem | 25mg | 2262.76 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[3-carboxy-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 1239233-87-4) is a chemical compound with the molecular formula C16H17NO5S and a molecular weight of 335.4 g/mol. IUPAC name: 2-[3-carboxy-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: WSCLTDCYZOTAKS-UHFFFAOYSA-N.
| Molecular formula | C16H17NO5S |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 2-[3-carboxy-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | WSCLTDCYZOTAKS-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=C(C=C2)OCC(C)C)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Febuxostat Acid, 2-[3-Carboxy-4-(2-methylpropoxy)phenyl]-4-methyl-5-thiazolecarboxylic Acid, 2-(3-Carboxy-4-isobutoxyphenyl)-4-methylthiazole-5-carboxylic acid, Febuxostat dicarboxylic acid impurity, Febuxostat impurity A, 2-[3-carboxy-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid, 2-[3-Carboxy-4-(2-methylpropoxy)phenyl]-4-methyl-5-thiazolecarboxylic Acid-d9, Febuxostat diacid impurity, 2-(3-carboxy-4-(2-methylpropoxy)phenyl)-4-methyl-5-thiazolecarboxylic acid, Febuxostat Imp XXII