cas: 1260023-79-7 — see every product listed under this CAS number, including other names
2-(3-Chloro-4-isopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98% (CAS 1260023-79-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A816144-250mg |
| cas | 1260023-79-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 776.44 Pln | |
| Ambeed | 25g | 2478.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A816144 |
2-(3-chloro-4-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1260023-79-7) is a chemical compound with the molecular formula C15H22BClO3 and a molecular weight of 296.6 g/mol. IUPAC name: 2-(3-chloro-4-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZEXZSHQHMWCQCI-UHFFFAOYSA-N.
| Molecular formula | C15H22BClO3 |
|---|---|
| Molecular weight | 296.6 g/mol |
| IUPAC name | 2-(3-chloro-4-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZEXZSHQHMWCQCI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OC(C)C)Cl |
Computed by PubChem (NCBI)