Products 1688655-72-2
CAS 1688655-72-2 appears in our catalog under these names: 3-Chloro-4-propoxyphenylboronic acid pinacol ester, 97%, 2-(3-Chloro-4-propoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 2-(3-Chloro-4-propoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, ≥95%, ≥95%, 3-Chloro-4-propoxyphenylboronic acid pinacol ester. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
2-(3-chloro-4-propoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1688655-72-2) is a chemical compound with the molecular formula C15H22BClO3 and a molecular weight of 296.6 g/mol. IUPAC name: 2-(3-chloro-4-propoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GTQWKZLJPCZUCQ-UHFFFAOYSA-N.
| Molecular formula | C15H22BClO3 |
|---|---|
| Molecular weight | 296.6 g/mol |
| IUPAC name | 2-(3-chloro-4-propoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GTQWKZLJPCZUCQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OCCC)Cl |
Computed by PubChem (NCBI)