CAS 1218789-41-3 appears in our catalog under these names: 3-Chloro-5-propoxyphenylboronic acid, pinacol ester, 98%, 2-(3-Chloro-5-propoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, 3-Chloro-5-propoxyphenylboronic acid, pinacol ester, 98%, 98%, 2-(3-Chloro-5-propoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
2-(3-chloro-5-propoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1218789-41-3) is a chemical compound with the molecular formula C15H22BClO3 and a molecular weight of 296.6 g/mol. IUPAC name: 2-(3-chloro-5-propoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: UHYRQTTUPFEKMU-UHFFFAOYSA-N.
| Molecular formula | C15H22BClO3 |
|---|---|
| Molecular weight | 296.6 g/mol |
| IUPAC name | 2-(3-chloro-5-propoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | UHYRQTTUPFEKMU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Cl)OCCC |
Computed by PubChem (NCBI)