CAS 889865-32-1 appears in our catalog under these names: 2-[4-(3-Chloropropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2-[4-(3-Chloropropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >95%, >95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g.
2-[4-(3-chloropropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 889865-32-1) is a chemical compound with the molecular formula C15H22BClO3 and a molecular weight of 296.6 g/mol. IUPAC name: 2-[4-(3-chloropropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: OPQUKGKJTWQAKY-UHFFFAOYSA-N.
| Molecular formula | C15H22BClO3 |
|---|---|
| Molecular weight | 296.6 g/mol |
| IUPAC name | 2-[4-(3-chloropropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | OPQUKGKJTWQAKY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCCCCl |
Computed by PubChem (NCBI)