cas: 942069-65-0 — see every product listed under this CAS number, including other names
2-(3-Chloro-5-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 942069-65-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219700-5G |
| cas | 942069-65-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 341.56 Pln | |
| Fluorochem | 25g | 1049.65 Pln | |
| Fluorochem | 100g | 4032.97 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-[3-chloro-5-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 942069-65-0) is a chemical compound with the molecular formula C13H15BClF3O2 and a molecular weight of 306.52 g/mol. IUPAC name: 2-[3-chloro-5-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DSRHHGXMHRASQY-UHFFFAOYSA-N.
| Molecular formula | C13H15BClF3O2 |
|---|---|
| Molecular weight | 306.52 g/mol |
| IUPAC name | 2-[3-chloro-5-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DSRHHGXMHRASQY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)