2-(3-Chloro-5-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%
cas: 942069-65-0 — see every product listed under this CAS number, including other names
2-(3-Chloro-5-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98% (CAS 942069-65-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ETL-250mg |
| cas | 942069-65-0 |
| size | 250mg |
| availability | 175g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 222.80 Pln | |
| Chemat | 25g | 870.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[3-chloro-5-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 942069-65-0) is a chemical compound with the molecular formula C13H15BClF3O2 and a molecular weight of 306.52 g/mol. IUPAC name: 2-[3-chloro-5-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DSRHHGXMHRASQY-UHFFFAOYSA-N.
| Molecular formula | C13H15BClF3O2 |
|---|---|
| Molecular weight | 306.52 g/mol |
| IUPAC name | 2-[3-chloro-5-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DSRHHGXMHRASQY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
2-[3-Chloro-5-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 3-Chloro-5-(trifluoromethyl)phenylboronic acid pinacol ester, 3-Chloro-5-(trifluoromethyl)phenylboronic acid, pinacol ester, 3-Chloro-5-(trifluoromethyl)benzeneboronic acid pinacol ester, 3-Chloro-5-(trifluoromet, DSRHHGXMHRASQY-UHFFFAOYSA-N