cas: 658066-44-5 — see every product listed under this CAS number, including other names
2-(3-Chloro-5-(trifluoromethyl)pyridin-2-yl)ethan-1-amine, 95% (CAS 658066-44-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F634866-100MG |
| cas | 658066-44-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 690.40 Pln | |
| Fluorochem | 250mg | 1122.54 Pln | |
| Fluorochem | 1g | 2903.16 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethanamine (CAS 658066-44-5) is a chemical compound with the molecular formula C8H8ClF3N2 and a molecular weight of 224.61 g/mol. IUPAC name: 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethanamine. InChIKey: BEESBQNARXNIDL-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF3N2 |
|---|---|
| Molecular weight | 224.61 g/mol |
| IUPAC name | 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethanamine |
| InChIKey | BEESBQNARXNIDL-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)CCN)C(F)(F)F |
Computed by PubChem (NCBI)