Products 1171756-10-7

CAS 1171756-10-7 is the registry number for 2-(Trifluoromethyl)benzamidine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(trifluoromethyl)benzenecarboximidamide;hydrochloride (CAS 1171756-10-7) is a chemical compound with the molecular formula C8H8ClF3N2 and a molecular weight of 224.61 g/mol. IUPAC name: 2-(trifluoromethyl)benzenecarboximidamide;hydrochloride. InChIKey: XGVJIKBARHCQHE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClF3N2
Molecular weight224.61 g/mol
IUPAC name2-(trifluoromethyl)benzenecarboximidamide;hydrochloride
InChIKeyXGVJIKBARHCQHE-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=N)N)C(F)(F)F.Cl

Computed by PubChem (NCBI)