Products 2813245-29-1
CAS 2813245-29-1 is the registry number for 5-Chloro-N,N-dimethyl-6-(trifluoromethyl)pyridin-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-N,N-dimethyl-6-(trifluoromethyl)pyridin-2-amine (CAS 2813245-29-1) is a chemical compound with the molecular formula C8H8ClF3N2 and a molecular weight of 224.61 g/mol. IUPAC name: 5-chloro-N,N-dimethyl-6-(trifluoromethyl)pyridin-2-amine. InChIKey: RNSLCGUQGDHWHH-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF3N2 |
|---|---|
| Molecular weight | 224.61 g/mol |
| IUPAC name | 5-chloro-N,N-dimethyl-6-(trifluoromethyl)pyridin-2-amine |
| InChIKey | RNSLCGUQGDHWHH-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=C(C=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)