CAS 1213516-89-2 is the registry number for (R)-4-(1-Amino-2,2,2-trifluoroethyl)-2-chloroaniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(1R)-1-amino-2,2,2-trifluoroethyl]-2-chloroaniline (CAS 1213516-89-2) is a chemical compound with the molecular formula C8H8ClF3N2 and a molecular weight of 224.61 g/mol. IUPAC name: 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-2-chloroaniline. InChIKey: JOZQVBOGROBJGD-SSDOTTSWSA-N.
| Molecular formula | C8H8ClF3N2 |
|---|---|
| Molecular weight | 224.61 g/mol |
| IUPAC name | 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-2-chloroaniline |
| InChIKey | JOZQVBOGROBJGD-SSDOTTSWSA-N |
| SMILES | C1=CC(=C(C=C1[C@H](C(F)(F)F)N)Cl)N |
Computed by PubChem (NCBI)