cas: 929626-16-4 — see every product listed under this CAS number, including other names
2-(3-Chloro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 929626-16-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F216079-250MG |
| cas | 929626-16-4 |
| size | 250mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 279.09 Pln | |
| Fluorochem | 5g | 1132.95 Pln | |
| Fluorochem | 25g | 5318.98 Pln | |
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 1026.75 Pln | |
| Ambeed | 25g | 4842.62 Pln | |
| Ambeed | 100g | 19154.94 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
2-(3-chloro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 929626-16-4) is a chemical compound with the molecular formula C13H18BClO3 and a molecular weight of 268.54 g/mol. IUPAC name: 2-(3-chloro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GEONBEFVLDNCSM-UHFFFAOYSA-N.
| Molecular formula | C13H18BClO3 |
|---|---|
| Molecular weight | 268.54 g/mol |
| IUPAC name | 2-(3-chloro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GEONBEFVLDNCSM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Cl)OC |
Computed by PubChem (NCBI)