Products 929626-16-4
CAS 929626-16-4 is the registry number for 2-(3-Chloro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g, 100g.
2-(3-chloro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 929626-16-4) is a chemical compound with the molecular formula C13H18BClO3 and a molecular weight of 268.54 g/mol. IUPAC name: 2-(3-chloro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GEONBEFVLDNCSM-UHFFFAOYSA-N.
| Molecular formula | C13H18BClO3 |
|---|---|
| Molecular weight | 268.54 g/mol |
| IUPAC name | 2-(3-chloro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GEONBEFVLDNCSM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Cl)OC |
Computed by PubChem (NCBI)