2-(3-Chlorophenyl)malondialdehyde
cas: 74963-16-9 — see every product listed under this CAS number, including other names
2-(3-Chlorophenyl)malondialdehyde (CAS 74963-16-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023532-250MG |
| cas | 74963-16-9 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 815.36 Pln | |
| Fluorochem | 1g | 1643.19 Pln | |
| Fluorochem | 2.5g | 2481.44 Pln | |
| Fluorochem | 5g | 3902.81 Pln | |
| Fluorochem | 10g | 6782.00 Pln |
properties
| delivery time | 2-3 weeks |
|---|
2-(3-chlorophenyl)propanedial (CAS 74963-16-9) is a chemical compound with the molecular formula C9H7ClO2 and a molecular weight of 182.60 g/mol. IUPAC name: 2-(3-chlorophenyl)propanedial. InChIKey: MFHYLDNKLVUJAR-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO2 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | 2-(3-chlorophenyl)propanedial |
| InChIKey | MFHYLDNKLVUJAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(C=O)C=O |
Computed by PubChem (NCBI)