cas: 408492-28-4 — see every product listed under this CAS number, including other names
2-(3-Iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98% (CAS 408492-28-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A829635-250mg |
| cas | 408492-28-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 476.06 Pln | |
| Ambeed | 25g | 1644.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A829635 |
2-(3-iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 408492-28-4) is a chemical compound with the molecular formula C12H16BIO2 and a molecular weight of 329.97 g/mol. IUPAC name: 2-(3-iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HSHFNMSHDHAHDN-UHFFFAOYSA-N.
| Molecular formula | C12H16BIO2 |
|---|---|
| Molecular weight | 329.97 g/mol |
| IUPAC name | 2-(3-iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HSHFNMSHDHAHDN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)I |
Computed by PubChem (NCBI)