cas: 2121514-73-4 — see every product listed under this CAS number, including other names
2-(3-Isopropoxy-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 2121514-73-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A716064-5g |
| cas | 2121514-73-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7771.33 Pln | |
| AmBeed | 25g | 25882.15 Pln | |
| AmBeed | 10g | 13187.65 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4,4,5,5-tetramethyl-2-(4-methyl-3-propan-2-yloxyphenyl)-1,3,2-dioxaborolane (CAS 2121514-73-4) is a chemical compound with the molecular formula C16H25BO3 and a molecular weight of 276.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-methyl-3-propan-2-yloxyphenyl)-1,3,2-dioxaborolane. InChIKey: MCGFRRPDEZOYOT-UHFFFAOYSA-N.
| Molecular formula | C16H25BO3 |
|---|---|
| Molecular weight | 276.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-methyl-3-propan-2-yloxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | MCGFRRPDEZOYOT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C)OC(C)C |
Computed by PubChem (NCBI)