Products 1688702-80-8
CAS 1688702-80-8 is the registry number for 4-Propoxy-2-methylphenylboronic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
4,4,5,5-tetramethyl-2-(2-methyl-4-propoxyphenyl)-1,3,2-dioxaborolane (CAS 1688702-80-8) is a chemical compound with the molecular formula C16H25BO3 and a molecular weight of 276.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methyl-4-propoxyphenyl)-1,3,2-dioxaborolane. InChIKey: XKZKJMFESWWGOR-UHFFFAOYSA-N.
| Molecular formula | C16H25BO3 |
|---|---|
| Molecular weight | 276.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methyl-4-propoxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | XKZKJMFESWWGOR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)OCCC)C |
Computed by PubChem (NCBI)