CAS 452914-21-5 appears in our catalog under these names: 2-(4-Butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2–(4–Butoxyphenyl)–4,4,5,5–tetramethyl–1,3,2–dioxaborolane, 2-(4-Butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95+%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 5g, 1g, 250mg.
2-(4-butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 452914-21-5) is a chemical compound with the molecular formula C16H25BO3 and a molecular weight of 276.2 g/mol. IUPAC name: 2-(4-butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VJLYRKSJEHDMPS-UHFFFAOYSA-N.
| Molecular formula | C16H25BO3 |
|---|---|
| Molecular weight | 276.2 g/mol |
| IUPAC name | 2-(4-butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VJLYRKSJEHDMPS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCCCC |
Computed by PubChem (NCBI)