Products 925916-55-8
CAS 925916-55-8 is the registry number for 2-(3-butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-(3-butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 925916-55-8) is a chemical compound with the molecular formula C16H25BO3 and a molecular weight of 276.2 g/mol. IUPAC name: 2-(3-butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BXUKKDURIZKNPS-UHFFFAOYSA-N.
| Molecular formula | C16H25BO3 |
|---|---|
| Molecular weight | 276.2 g/mol |
| IUPAC name | 2-(3-butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BXUKKDURIZKNPS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCCCC |
Computed by PubChem (NCBI)