cas: 115299-08-6 — see every product listed under this CAS number, including other names
2-(3-Methoxy-phenyl)-thiazole-4-carboxylic acid ethyl ester, 95%, 95% (CAS 115299-08-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111GK0-100mg |
| cas | 115299-08-6 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 405.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(3-methoxyphenyl)-1,3-thiazole-4-carboxylate (CAS 115299-08-6) is a chemical compound with the molecular formula C13H13NO3S and a molecular weight of 263.31 g/mol. IUPAC name: ethyl 2-(3-methoxyphenyl)-1,3-thiazole-4-carboxylate. InChIKey: HOLLTDYJCZTSFF-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3S |
|---|---|
| Molecular weight | 263.31 g/mol |
| IUPAC name | ethyl 2-(3-methoxyphenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | HOLLTDYJCZTSFF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C2=CC(=CC=C2)OC |
Computed by PubChem (NCBI)