Products 115299-16-6

CAS 115299-16-6 is the registry number for 2-(2-Methoxy-phenyl)-thiazole-4-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(2-methoxyphenyl)-1,3-thiazole-4-carboxylate (CAS 115299-16-6) is a chemical compound with the molecular formula C13H13NO3S and a molecular weight of 263.31 g/mol. IUPAC name: ethyl 2-(2-methoxyphenyl)-1,3-thiazole-4-carboxylate. InChIKey: BKXAMRGQLUBAPE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO3S
Molecular weight263.31 g/mol
IUPAC nameethyl 2-(2-methoxyphenyl)-1,3-thiazole-4-carboxylate
InChIKeyBKXAMRGQLUBAPE-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CSC(=N1)C2=CC=CC=C2OC

Computed by PubChem (NCBI)