Products 76410-74-7
CAS 76410-74-7 is the registry number for 4-Hydroxy-n-(4-methylphenyl)benzene-1-sulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-hydroxy-N-(4-methylphenyl)benzenesulfonamide (CAS 76410-74-7) is a chemical compound with the molecular formula C13H13NO3S and a molecular weight of 263.31 g/mol. IUPAC name: 4-hydroxy-N-(4-methylphenyl)benzenesulfonamide. InChIKey: YDTOKHWWMIXCQB-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3S |
|---|---|
| Molecular weight | 263.31 g/mol |
| IUPAC name | 4-hydroxy-N-(4-methylphenyl)benzenesulfonamide |
| InChIKey | YDTOKHWWMIXCQB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)