CAS 37572-23-9 appears in our catalog under these names: Methyl 3-amino-5-(4-methoxyphenyl)thiophene-2-carboxylate, 95%, Methyl 3-amino-5-(4-methoxyphenyl)thiophene-2-carboxylate, 95+%, 3-Amino-5-(4-methoxyphenyl)thiophene-2-carboxylic acid methyl ester. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.
Methyl 3-amino-5-(4-methoxyphenyl)thiophene-2-carboxylate (CAS 37572-23-9) is a chemical compound with the molecular formula C13H13NO3S and a molecular weight of 263.31 g/mol. IUPAC name: methyl 3-amino-5-(4-methoxyphenyl)thiophene-2-carboxylate. InChIKey: CBUIWNUZMRQRPZ-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3S |
|---|---|
| Molecular weight | 263.31 g/mol |
| IUPAC name | methyl 3-amino-5-(4-methoxyphenyl)thiophene-2-carboxylate |
| InChIKey | CBUIWNUZMRQRPZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=C(S2)C(=O)OC)N |
Computed by PubChem (NCBI)