CAS 25055-84-9 appears in our catalog under these names: 2–(3–Methyl–3H–diazirin–3–yl)ethyl 4–methylbenzenesulfonate, 2-(3-Methyl-3H-diazirin-3-yl)ethyl 4-methylbenzenesulfonate, 97%, 97%, 2-(3-METHYL-3H-DIAZIRIN-3-YL)ETHYL 4-METHYLBENZENESULFONATE, 98%, 2-(3-Methyl-3H-diazirin-3-yl)ethyl 4-methylbenzenesulfonate, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 50mg, 250mg, 1g, 5g.
2-(3-methyldiazirin-3-yl)ethyl 4-methylbenzenesulfonate (CAS 25055-84-9) is a chemical compound with the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. IUPAC name: 2-(3-methyldiazirin-3-yl)ethyl 4-methylbenzenesulfonate. InChIKey: MZQMGXQUJVZNBT-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O3S |
|---|---|
| Molecular weight | 254.31 g/mol |
| IUPAC name | 2-(3-methyldiazirin-3-yl)ethyl 4-methylbenzenesulfonate |
| InChIKey | MZQMGXQUJVZNBT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCC2(N=N2)C |
Computed by PubChem (NCBI)