CAS 1489354-43-9 is the registry number for 1-(Methyl((4-methylthiazol-5-yl)methyl)carbamoyl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]carbamoyl]cyclopropane-1-carboxylic acid (CAS 1489354-43-9) is a chemical compound with the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. IUPAC name: 1-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]carbamoyl]cyclopropane-1-carboxylic acid. InChIKey: JWBGXUKVRKEAMN-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O3S |
|---|---|
| Molecular weight | 254.31 g/mol |
| IUPAC name | 1-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]carbamoyl]cyclopropane-1-carboxylic acid |
| InChIKey | JWBGXUKVRKEAMN-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=N1)CN(C)C(=O)C2(CC2)C(=O)O |
Computed by PubChem (NCBI)