Products 1201594-39-9

CAS 1201594-39-9 is the registry number for 1-Methyl-1H-indol-5-yl dimethylsulfamate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

(1-methylindol-5-yl) N,N-dimethylsulfamate (CAS 1201594-39-9) is a chemical compound with the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. IUPAC name: (1-methylindol-5-yl) N,N-dimethylsulfamate. InChIKey: SFKPPSXGZHLZQN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14N2O3S
Molecular weight254.31 g/mol
IUPAC name(1-methylindol-5-yl) N,N-dimethylsulfamate
InChIKeySFKPPSXGZHLZQN-UHFFFAOYSA-N
SMILESCN1C=CC2=C1C=CC(=C2)OS(=O)(=O)N(C)C

Computed by PubChem (NCBI)